cas: 1235036-15-3 — see every product listed under this CAS number, including other names
tert-Butyl 3-bromo-6-chloropicolinate, 95% (CAS 1235036-15-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F232892-250MG |
| cas | 1235036-15-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 482.14 Pln | |
| Fluorochem | 10g | 903.87 Pln | |
| Fluorochem | 25g | 1939.96 Pln | |
| Fluorochem | 100g | 7516.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-bromo-6-chloropyridine-2-carboxylate (CAS 1235036-15-3) is a chemical compound with the molecular formula C10H11BrClNO2 and a molecular weight of 292.55 g/mol. IUPAC name: tert-butyl 3-bromo-6-chloropyridine-2-carboxylate. InChIKey: JKGXLKXQUDHRLL-UHFFFAOYSA-N.
| Molecular formula | C10H11BrClNO2 |
|---|---|
| Molecular weight | 292.55 g/mol |
| IUPAC name | tert-butyl 3-bromo-6-chloropyridine-2-carboxylate |
| InChIKey | JKGXLKXQUDHRLL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=CC(=N1)Cl)Br |
Computed by PubChem (NCBI)