cas: 1430753-76-6 — see every product listed under this CAS number, including other names
tert-Butyl 3-bromo-6-fluoropicolinate 97% (CAS 1430753-76-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A634125-250mg |
| cas | 1430753-76-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 426.00 Pln | |
| Ambeed | 1g | 932.19 Pln | |
| Ambeed | 5g | 3579.94 Pln | |
| Ambeed | 10g | 6249.94 Pln | |
| Ambeed | 25g | 13058.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A634125 |
Tert-butyl 3-bromo-6-fluoropyridine-2-carboxylate (CAS 1430753-76-6) is a chemical compound with the molecular formula C10H11BrFNO2 and a molecular weight of 276.10 g/mol. IUPAC name: tert-butyl 3-bromo-6-fluoropyridine-2-carboxylate. InChIKey: XXVBLAQLDHKBSP-UHFFFAOYSA-N.
| Molecular formula | C10H11BrFNO2 |
|---|---|
| Molecular weight | 276.10 g/mol |
| IUPAC name | tert-butyl 3-bromo-6-fluoropyridine-2-carboxylate |
| InChIKey | XXVBLAQLDHKBSP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=CC(=N1)F)Br |
Computed by PubChem (NCBI)