cas: 91419-53-3 — see every product listed under this CAS number, including other names
tert-Butyl 3-cyanopiperidine-1-carboxylate 97% (CAS 91419-53-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A129293-5g |
| cas | 91419-53-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 281.38 Pln | |
| Ambeed | 100g | 687.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A129293 |
Tert-butyl 3-cyanopiperidine-1-carboxylate (CAS 91419-53-3) is a chemical compound with the molecular formula C11H18N2O2 and a molecular weight of 210.27 g/mol. IUPAC name: tert-butyl 3-cyanopiperidine-1-carboxylate. InChIKey: UEFZTXGFHKPSFS-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | tert-butyl 3-cyanopiperidine-1-carboxylate |
| InChIKey | UEFZTXGFHKPSFS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)C#N |
Computed by PubChem (NCBI)