cas: 1331825-50-3 — see every product listed under this CAS number, including other names
tert-Butyl 3-hydroxy-1-oxa-7-azaspiro[4.4]nonane-7-carboxylate 98% (CAS 1331825-50-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A652889-10g |
| cas | 1331825-50-3 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 8385.94 Pln | |
| Ambeed | 100mg | 348.12 Pln | |
| Ambeed | 250mg | 604.00 Pln | |
| Ambeed | 1g | 1833.31 Pln | |
| Ambeed | 5g | 5265.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A652889 |
Tert-butyl 3-hydroxy-1-oxa-7-azaspiro[4.4]nonane-7-carboxylate (CAS 1331825-50-3) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: tert-butyl 3-hydroxy-1-oxa-7-azaspiro[4.4]nonane-7-carboxylate. InChIKey: QMWZANYLPBQFME-UHFFFAOYSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | tert-butyl 3-hydroxy-1-oxa-7-azaspiro[4.4]nonane-7-carboxylate |
| InChIKey | QMWZANYLPBQFME-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)CC(CO2)O |
Computed by PubChem (NCBI)