tert-Butyl 3-iodobenzoate, 97%
cas: 173406-17-2 — see every product listed under this CAS number, including other names
tert-Butyl 3-iodobenzoate, 97% (CAS 173406-17-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216108-250MG |
| cas | 173406-17-2 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 5g | 810.15 Pln | |
| Fluorochem | 10g | 1559.89 Pln | |
| Fluorochem | 25g | 2559.53 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 3-iodobenzoate (CAS 173406-17-2) is a chemical compound with the molecular formula C11H13IO2 and a molecular weight of 304.12 g/mol. IUPAC name: tert-butyl 3-iodobenzoate. InChIKey: XZUWLKIILSZGIR-UHFFFAOYSA-N.
| Molecular formula | C11H13IO2 |
|---|---|
| Molecular weight | 304.12 g/mol |
| IUPAC name | tert-butyl 3-iodobenzoate |
| InChIKey | XZUWLKIILSZGIR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=CC=C1)I |
Computed by PubChem (NCBI)