cas: 890091-87-9 — see every product listed under this CAS number, including other names
tert-Butyl 3-oxo-3,5,7,8-tetrahydropyrido[4,3-c]pyridazine-6(2H)-carboxylate, 98%, 98% (CAS 890091-87-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1199UH-100mg |
| cas | 890091-87-9 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 458.00 Pln | |
| Chemat | 1g | 1053.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-oxo-2,5,7,8-tetrahydropyrido[4,3-c]pyridazine-6-carboxylate (CAS 890091-87-9) is a chemical compound with the molecular formula C12H17N3O3 and a molecular weight of 251.28 g/mol. IUPAC name: tert-butyl 3-oxo-2,5,7,8-tetrahydropyrido[4,3-c]pyridazine-6-carboxylate. InChIKey: CEWAOXZXQMSMQT-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O3 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | tert-butyl 3-oxo-2,5,7,8-tetrahydropyrido[4,3-c]pyridazine-6-carboxylate |
| InChIKey | CEWAOXZXQMSMQT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=NNC(=O)C=C2C1 |
Computed by PubChem (NCBI)