cas: 1026796-78-0 — see every product listed under this CAS number, including other names
tert-Butyl 3-vinylazetidine-1-carboxylate (CAS 1026796-78-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F465125-100MG |
| cas | 1026796-78-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 414.46 Pln | |
| Fluorochem | 250mg | 622.72 Pln | |
| Fluorochem | 500mg | 1101.71 Pln | |
| Fluorochem | 1g | 1440.14 Pln | |
| Fluorochem | 5g | 4496.35 Pln | |
| Fluorochem | 10g | 7453.64 Pln |
| delivery time | 1-2 weeks |
|---|
Tert-butyl 3-ethenylazetidine-1-carboxylate (CAS 1026796-78-0) is a chemical compound with the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. IUPAC name: tert-butyl 3-ethenylazetidine-1-carboxylate. InChIKey: YASOUSGMWNLROI-UHFFFAOYSA-N.
| Molecular formula | C10H17NO2 |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | tert-butyl 3-ethenylazetidine-1-carboxylate |
| InChIKey | YASOUSGMWNLROI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)C=C |
Computed by PubChem (NCBI)