Products 792136-91-5

CAS 792136-91-5 is the registry number for 4-(Methylamino)bicyclo[2.2.2]octane-1-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

4-(methylamino)bicyclo[2.2.2]octane-1-carboxylic acid (CAS 792136-91-5) is a chemical compound with the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. IUPAC name: 4-(methylamino)bicyclo[2.2.2]octane-1-carboxylic acid. InChIKey: LAWJGOVDTLLKQG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17NO2
Molecular weight183.25 g/mol
IUPAC name4-(methylamino)bicyclo[2.2.2]octane-1-carboxylic acid
InChIKeyLAWJGOVDTLLKQG-UHFFFAOYSA-N
SMILESCNC12CCC(CC1)(CC2)C(=O)O

Computed by PubChem (NCBI)