CAS 192436-84-3 is the registry number for Methyl (2S,3aS,7aS)-octahydro-1H-indole-2-carboxylate, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Methyl (2S,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylate (CAS 192436-84-3) is a chemical compound with the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. IUPAC name: methyl (2S,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylate. InChIKey: OITFEJDUSSGRIH-CIUDSAMLSA-N.
| Molecular formula | C10H17NO2 |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | methyl (2S,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylate |
| InChIKey | OITFEJDUSSGRIH-CIUDSAMLSA-N |
| SMILES | COC(=O)[C@@H]1C[C@@H]2CCCC[C@@H]2N1 |
Computed by PubChem (NCBI)