cas: 1425970-61-1 — see every product listed under this CAS number, including other names
tert-Butyl 4-((4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylene)piperidine-1-carboxylate 98% (CAS 1425970-61-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A925071-100mg |
| cas | 1425970-61-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 236.88 Pln | |
| Ambeed | 5g | 743.06 Pln | |
| Ambeed | 25g | 3001.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A925071 |
Tert-butyl 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]piperidine-1-carboxylate (CAS 1425970-61-1) is a chemical compound with the molecular formula C17H30BNO4 and a molecular weight of 323.2 g/mol. IUPAC name: tert-butyl 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]piperidine-1-carboxylate. InChIKey: RJANMUJZJKCWID-UHFFFAOYSA-N.
| Molecular formula | C17H30BNO4 |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | tert-butyl 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]piperidine-1-carboxylate |
| InChIKey | RJANMUJZJKCWID-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C=C2CCN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)