cas: 1334499-61-4 — see every product listed under this CAS number, including other names
tert-Butyl 4-(2-((tert-butoxycarbonyl)amino)ethyl)benzoate, 95%, 95% (CAS 1334499-61-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HSXF-100mg |
| cas | 1334499-61-4 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 506.00 Pln | |
| Chemat | 250mg | 875.60 Pln | |
| Chemat | 500mg | 1350.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]benzoate (CAS 1334499-61-4) is a chemical compound with the molecular formula C18H27NO4 and a molecular weight of 321.4 g/mol. IUPAC name: tert-butyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]benzoate. InChIKey: PHRXTBWKGDZUSX-UHFFFAOYSA-N.
| Molecular formula | C18H27NO4 |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | tert-butyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]benzoate |
| InChIKey | PHRXTBWKGDZUSX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=C(C=C1)CCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)