cas: 198627-86-0 — see every product listed under this CAS number, including other names
tert-Butyl 4-(3-hydroxyphenyl)piperazine-1-carboxylate, 95% (CAS 198627-86-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F385359-250MG |
| cas | 198627-86-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 263.47 Pln | |
| Fluorochem | 500mg | 456.11 Pln | |
| Fluorochem | 1g | 502.97 Pln | |
| Fluorochem | 2.5g | 966.34 Pln | |
| Fluorochem | 5g | 1580.71 Pln | |
| Fluorochem | 10g | 2918.78 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4-(3-hydroxyphenyl)piperazine-1-carboxylate (CAS 198627-86-0) is a chemical compound with the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. IUPAC name: tert-butyl 4-(3-hydroxyphenyl)piperazine-1-carboxylate. InChIKey: MIQHJGPQPMQVOT-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O3 |
|---|---|
| Molecular weight | 278.35 g/mol |
| IUPAC name | tert-butyl 4-(3-hydroxyphenyl)piperazine-1-carboxylate |
| InChIKey | MIQHJGPQPMQVOT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)