cas: 1197294-80-6 — see every product listed under this CAS number, including other names
tert-Butyl 4-(4-bromopyridin-2-yl)piperazine-1-carboxylate, 95% (CAS 1197294-80-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F213544-250MG |
| cas | 1197294-80-6 |
| size | 250mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 726.85 Pln | |
| Fluorochem | 10g | 1231.88 Pln | |
| Fluorochem | 25g | 2497.06 Pln | |
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 731.94 Pln | |
| Ambeed | 10g | 1232.56 Pln | |
| Ambeed | 25g | 2422.94 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Tert-butyl 4-(4-bromo-2-pyridinyl)piperazine-1-carboxylate (CAS 1197294-80-6) is a chemical compound with the molecular formula C14H20BrN3O2 and a molecular weight of 342.23 g/mol. IUPAC name: tert-butyl 4-(4-bromo-2-pyridinyl)piperazine-1-carboxylate. InChIKey: WVPSXULRTJKBMJ-UHFFFAOYSA-N.
| Molecular formula | C14H20BrN3O2 |
|---|---|
| Molecular weight | 342.23 g/mol |
| IUPAC name | tert-butyl 4-(4-bromo-2-pyridinyl)piperazine-1-carboxylate |
| InChIKey | WVPSXULRTJKBMJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=NC=CC(=C2)Br |
Computed by PubChem (NCBI)