cas: 1201916-87-1 — see every product listed under this CAS number, including other names
tert-Butyl 4-(4-nitro-1H-pyrazol-1-yl)piperidine-1-carboxylate, 98% (CAS 1201916-87-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 1g, 5g, 250mg, 2.5g. Offered by: Combi-blocks, AmBeed, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | SS-3797-10g |
| cas | 1201916-87-1 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| AmBeed | 25g | 5317.06 Pln | |
| AmBeed | 250mg | 486.64 Pln | |
| Fluorochem | 250mg | 346.77 Pln | |
| Fluorochem | 1g | 372.80 Pln | |
| Fluorochem | 2.5g | 841.39 Pln | |
| Fluorochem | 5g | 1002.79 Pln | |
| Fluorochem | 10g | 1736.91 Pln | |
| Fluorochem | 25g | 3319.68 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Tert-butyl 4-(4-nitropyrazol-1-yl)piperidine-1-carboxylate (CAS 1201916-87-1) is a chemical compound with the molecular formula C13H20N4O4 and a molecular weight of 296.32 g/mol. IUPAC name: tert-butyl 4-(4-nitropyrazol-1-yl)piperidine-1-carboxylate. InChIKey: JKRMWACLUFEWPC-UHFFFAOYSA-N.
| Molecular formula | C13H20N4O4 |
|---|---|
| Molecular weight | 296.32 g/mol |
| IUPAC name | tert-butyl 4-(4-nitropyrazol-1-yl)piperidine-1-carboxylate |
| InChIKey | JKRMWACLUFEWPC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)N2C=C(C=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)