cas: 138227-62-0 — see every product listed under this CAS number, including other names
tert-Butyl 4-(4-nitrophenoxy)piperidine-1-carboxylate 98% (CAS 138227-62-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A369767-250mg |
| cas | 138227-62-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1010.06 Pln | |
| Ambeed | 10g | 1816.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A369767 |
Tert-butyl 4-(4-nitrophenoxy)piperidine-1-carboxylate (CAS 138227-62-0) is a chemical compound with the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. IUPAC name: tert-butyl 4-(4-nitrophenoxy)piperidine-1-carboxylate. InChIKey: UNNMTKGKCWNQNU-UHFFFAOYSA-N.
| Molecular formula | C16H22N2O5 |
|---|---|
| Molecular weight | 322.36 g/mol |
| IUPAC name | tert-butyl 4-(4-nitrophenoxy)piperidine-1-carboxylate |
| InChIKey | UNNMTKGKCWNQNU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)