cas: 301185-41-1 — see every product listed under this CAS number, including other names
tert-Butyl 4-(prop-2-yn-1-yl)piperidine-1-carboxylate 97% (CAS 301185-41-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A857125-100mg |
| cas | 301185-41-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 214.62 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 648.50 Pln | |
| Ambeed | 5g | 2267.19 Pln | |
| Ambeed | 25g | 7896.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A857125 |
Tert-butyl 4-prop-2-ynylpiperidine-1-carboxylate (CAS 301185-41-1) is a chemical compound with the molecular formula C13H21NO2 and a molecular weight of 223.31 g/mol. IUPAC name: tert-butyl 4-prop-2-ynylpiperidine-1-carboxylate. InChIKey: CHTFWVDBUXUMCE-UHFFFAOYSA-N.
| Molecular formula | C13H21NO2 |
|---|---|
| Molecular weight | 223.31 g/mol |
| IUPAC name | tert-butyl 4-prop-2-ynylpiperidine-1-carboxylate |
| InChIKey | CHTFWVDBUXUMCE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CC#C |
Computed by PubChem (NCBI)