cas: 2624138-75-4 — see every product listed under this CAS number, including other names
tert-Butyl 4-(pyrrolidin-3-yl)piperazine-1-carboxylate hydrochloride, 95% (CAS 2624138-75-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F719706-100MG |
| cas | 2624138-75-4 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 414.46 Pln | |
| Fluorochem | 250mg | 685.19 Pln | |
| Fluorochem | 500mg | 1309.97 Pln | |
| Fluorochem | 1g | 1528.65 Pln | |
| Fluorochem | 2.5g | 2575.15 Pln | |
| Fluorochem | 5g | 4085.04 Pln | |
| Fluorochem | 10g | 6547.71 Pln | |
| Fluorochem | 25g | 15086.37 Pln | |
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 410.00 Pln | |
| Chemat | 1g | 890.00 Pln | |
| Chemat | 5g | 2766.80 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Tert-butyl 4-pyrrolidin-3-ylpiperazine-1-carboxylate;hydrochloride (CAS 2624138-75-4) is a chemical compound with the molecular formula C13H26ClN3O2 and a molecular weight of 291.82 g/mol. IUPAC name: tert-butyl 4-pyrrolidin-3-ylpiperazine-1-carboxylate;hydrochloride. InChIKey: FHSVIZJKUQIKMW-UHFFFAOYSA-N.
| Molecular formula | C13H26ClN3O2 |
|---|---|
| Molecular weight | 291.82 g/mol |
| IUPAC name | tert-butyl 4-pyrrolidin-3-ylpiperazine-1-carboxylate;hydrochloride |
| InChIKey | FHSVIZJKUQIKMW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2CCNC2.Cl |
Computed by PubChem (NCBI)