tert-Butyl 4-amino-3-methylbenzoate, 98%
cas: 934481-43-3 — see every product listed under this CAS number, including other names
tert-Butyl 4-amino-3-methylbenzoate, 98% (CAS 934481-43-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A367733-250mg |
| cas | 934481-43-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 570.62 Pln | |
| Ambeed | 5g | 1655.31 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 515.60 Pln | |
| Chemat | 5g | 1648.40 Pln | |
| BLDpharm | 250mg | 308.80 Pln | |
| BLDpharm | 1g | 614.25 Pln | |
| BLDpharm | 5g | 1780.51 Pln | |
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 555.03 Pln | |
| Fluorochem | 5g | 1632.78 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl 4-amino-3-methylbenzoate (CAS 934481-43-3) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: tert-butyl 4-amino-3-methylbenzoate. InChIKey: HFMIRAQWPTZEAH-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | tert-butyl 4-amino-3-methylbenzoate |
| InChIKey | HFMIRAQWPTZEAH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)