Products 934481-43-3
CAS 934481-43-3 appears in our catalog under these names: tert-Butyl 4-amino-3-methylbenzoate, 98%, tert-Butyl 4-amino-3-methylbenzoate, 98%, 98%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
Tert-butyl 4-amino-3-methylbenzoate (CAS 934481-43-3) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: tert-butyl 4-amino-3-methylbenzoate. InChIKey: HFMIRAQWPTZEAH-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | tert-butyl 4-amino-3-methylbenzoate |
| InChIKey | HFMIRAQWPTZEAH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)