cas: 331281-25-5 — see every product listed under this CAS number, including other names
tert-Butyl 4-amino-4-cyanopiperidine-1-carboxylate (CAS 331281-25-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F241896-100MG |
| cas | 331281-25-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 299.91 Pln | |
| Fluorochem | 250mg | 440.49 Pln | |
| Fluorochem | 500mg | 476.93 Pln | |
| Fluorochem | 1g | 763.29 Pln | |
| Fluorochem | 5g | 2361.69 Pln | |
| Fluorochem | 10g | 4527.59 Pln |
| delivery time | 3-4 weeks |
|---|
Tert-butyl 4-amino-4-cyanopiperidine-1-carboxylate (CAS 331281-25-5) is a chemical compound with the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. IUPAC name: tert-butyl 4-amino-4-cyanopiperidine-1-carboxylate. InChIKey: ZDAOYEIIJSEFSW-UHFFFAOYSA-N.
| Molecular formula | C11H19N3O2 |
|---|---|
| Molecular weight | 225.29 g/mol |
| IUPAC name | tert-butyl 4-amino-4-cyanopiperidine-1-carboxylate |
| InChIKey | ZDAOYEIIJSEFSW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C#N)N |
Computed by PubChem (NCBI)