cas: 614730-96-0 — see every product listed under this CAS number, including other names
tert-Butyl 4-cyano-4-(hydroxymethyl)piperidine-1-carboxylate 98% (CAS 614730-96-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A333766-10g |
| cas | 614730-96-0 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 1989.06 Pln | |
| Ambeed | 100g | 10699.94 Pln | |
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1132.44 Pln | |
| Ambeed | 25g | 3897.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A333766 |
Tert-butyl 4-cyano-4-(hydroxymethyl)piperidine-1-carboxylate (CAS 614730-96-0) is a chemical compound with the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. IUPAC name: tert-butyl 4-cyano-4-(hydroxymethyl)piperidine-1-carboxylate. InChIKey: BLZNRLWYSXQYLO-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O3 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | tert-butyl 4-cyano-4-(hydroxymethyl)piperidine-1-carboxylate |
| InChIKey | BLZNRLWYSXQYLO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(CO)C#N |
Computed by PubChem (NCBI)