tert-Butyl 4-cyanoazepane-1-carboxylate, 97%
cas: 1259056-34-2 — see every product listed under this CAS number, including other names
tert-Butyl 4-cyanoazepane-1-carboxylate, 97% (CAS 1259056-34-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A149850-250mg |
| cas | 1259056-34-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 398.19 Pln | |
| Ambeed | 5g | 1093.50 Pln | |
| Ambeed | 10g | 1727.62 Pln | |
| Ambeed | 25g | 3090.44 Pln | |
| Ambeed | 100g | 8130.06 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 237.20 Pln | |
| Chemat | 5g | 846.80 Pln | |
| Chemat | 10g | 1394.00 Pln | |
| Chemat | 25g | 2646.80 Pln | |
| Chemat | 100g | 7110.80 Pln | |
| BLDpharm | 250mg | 203.29 Pln | |
| BLDpharm | 1g | 425.43 Pln | |
| BLDpharm | 5g | 1169.61 Pln | |
| BLDpharm | 10g | 1858.26 Pln | |
| BLDpharm | 25g | 3329.96 Pln | |
| BLDpharm | 100g | 8761.38 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 4-cyanoazepane-1-carboxylate (CAS 1259056-34-2) is a chemical compound with the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. IUPAC name: tert-butyl 4-cyanoazepane-1-carboxylate. InChIKey: GWIFZKJNRMQRJU-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O2 |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | tert-butyl 4-cyanoazepane-1-carboxylate |
| InChIKey | GWIFZKJNRMQRJU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CC1)C#N |
Computed by PubChem (NCBI)
