tert-Butyl 4-ethylidenepiperidine-1-carboxylate, 95%
cas: 889955-48-0 — see every product listed under this CAS number, including other names
tert-Butyl 4-ethylidenepiperidine-1-carboxylate, 95% (CAS 889955-48-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A818337-100mg |
| cas | 889955-48-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 309.19 Pln | |
| Ambeed | 250mg | 498.31 Pln | |
| Ambeed | 1g | 1199.19 Pln | |
| Ambeed | 5g | 3802.44 Pln | |
| BLDpharm | 100mg | 331.02 Pln | |
| BLDpharm | 250mg | 536.50 Pln | |
| BLDpharm | 1g | 1291.79 Pln | |
| BLDpharm | 5g | 4096.36 Pln | |
| Chemat | 100mg | 314.00 Pln | |
| Chemat | 250mg | 515.60 Pln | |
| Chemat | 1g | 1235.60 Pln | |
| Chemat | 5g | 3933.20 Pln | |
| Fluorochem | 100mg | 560.24 Pln | |
| Fluorochem | 250mg | 945.52 Pln | |
| Fluorochem | 1g | 2294.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 4-ethylidenepiperidine-1-carboxylate (CAS 889955-48-0) is a chemical compound with the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. IUPAC name: tert-butyl 4-ethylidenepiperidine-1-carboxylate. InChIKey: XQMRPSPROJYUJM-UHFFFAOYSA-N.
| Molecular formula | C12H21NO2 |
|---|---|
| Molecular weight | 211.30 g/mol |
| IUPAC name | tert-butyl 4-ethylidenepiperidine-1-carboxylate |
| InChIKey | XQMRPSPROJYUJM-UHFFFAOYSA-N |
| SMILES | CC=C1CCN(CC1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)