cas: 367500-88-7 — see every product listed under this CAS number, including other names
tert-Butyl 4-hydroxy-[1,4'-bipiperidine]-1'-carboxylate 95% (CAS 367500-88-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A485506-250mg |
| cas | 367500-88-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1538.50 Pln | |
| Ambeed | 10g | 2584.25 Pln | |
| Ambeed | 25g | 5098.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A485506 |
Tert-butyl 4-(4-hydroxypiperidin-1-yl)piperidine-1-carboxylate (CAS 367500-88-7) is a chemical compound with the molecular formula C15H28N2O3 and a molecular weight of 284.39 g/mol. IUPAC name: tert-butyl 4-(4-hydroxypiperidin-1-yl)piperidine-1-carboxylate. InChIKey: NHZHORRSIJNTSZ-UHFFFAOYSA-N.
| Molecular formula | C15H28N2O3 |
|---|---|
| Molecular weight | 284.39 g/mol |
| IUPAC name | tert-butyl 4-(4-hydroxypiperidin-1-yl)piperidine-1-carboxylate |
| InChIKey | NHZHORRSIJNTSZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)N2CCC(CC2)O |
Computed by PubChem (NCBI)