CAS 149505-94-2 appears in our catalog under these names: tert–Butyl 4–hydroxybenzylcarbamate, tert-Butyl 4-hydroxybenzylcarbamate, Carbamic acid, (4-hydroxyphenyl)methyl-, 1,1-dimethylethyl ester, 97%, 97%, tert-Butyl 4-hydroxybenzylcarbamate, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 2,5g, 25g, 1g, 5g, 100mg, 10g, 15g.
Tert-butyl N-[(4-hydroxyphenyl)methyl]carbamate (CAS 149505-94-2) is a chemical compound with the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. IUPAC name: tert-butyl N-[(4-hydroxyphenyl)methyl]carbamate. InChIKey: PONJIMVVHPQAJL-UHFFFAOYSA-N.
| Molecular formula | C12H17NO3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | tert-butyl N-[(4-hydroxyphenyl)methyl]carbamate |
| InChIKey | PONJIMVVHPQAJL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC=C(C=C1)O |
Computed by PubChem (NCBI)