cas: 1260794-50-0 — see every product listed under this CAS number, including other names
tert-Butyl 5-fluoropyridin-2-ylcarbamate (CAS 1260794-50-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F637997-250MG |
| cas | 1260794-50-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 799.74 Pln | |
| Fluorochem | 1g | 1882.69 Pln | |
| Fluorochem | 5g | 3840.33 Pln | |
| Fluorochem | 10g | 5725.09 Pln |
| delivery time | 3-4 weeks |
|---|
Tert-butyl N-(5-fluoro-2-pyridinyl)carbamate (CAS 1260794-50-0) is a chemical compound with the molecular formula C10H13FN2O2 and a molecular weight of 212.22 g/mol. IUPAC name: tert-butyl N-(5-fluoro-2-pyridinyl)carbamate. InChIKey: QJKDSHHDJJUUNY-UHFFFAOYSA-N.
| Molecular formula | C10H13FN2O2 |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | tert-butyl N-(5-fluoro-2-pyridinyl)carbamate |
| InChIKey | QJKDSHHDJJUUNY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=C(C=C1)F |
Computed by PubChem (NCBI)