cas: 1251005-61-4 — see every product listed under this CAS number, including other names
tert-Butyl 5-oxa-2,8-diazaspiro[3.5]nonane-8-carboxylate, 97%, 97% (CAS 1251005-61-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111N6P-100mg |
| cas | 1251005-61-4 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 386.00 Pln | |
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 500mg | 990.80 Pln | |
| Chemat | 1g | 1336.40 Pln | |
| Chemat | 5g | 5320.40 Pln | |
| Chemat | 10g | 9347.60 Pln | |
| Chemat | 25g | 18630.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 5-oxa-2,8-diazaspiro[3.5]nonane-8-carboxylate (CAS 1251005-61-4) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl 5-oxa-2,8-diazaspiro[3.5]nonane-8-carboxylate. InChIKey: HDVGQNDLJKJMJF-UHFFFAOYSA-N.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl 5-oxa-2,8-diazaspiro[3.5]nonane-8-carboxylate |
| InChIKey | HDVGQNDLJKJMJF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC2(C1)CNC2 |
Computed by PubChem (NCBI)