cas: 1251005-61-4 — see every product listed under this CAS number, including other names
tert-Butyl 5-oxa-2,8-diazaspiro[3.5]nonane-8-carboxylate, 97% (CAS 1251005-61-4) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 50mg, 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F214526-500MG |
| cas | 1251005-61-4 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 1002.79 Pln | |
| Fluorochem | 1g | 1632.78 Pln | |
| Fluorochem | 50mg | 299.91 Pln | |
| Fluorochem | 100mg | 383.22 Pln | |
| Fluorochem | 250mg | 529.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 5-oxa-2,8-diazaspiro[3.5]nonane-8-carboxylate (CAS 1251005-61-4) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl 5-oxa-2,8-diazaspiro[3.5]nonane-8-carboxylate. InChIKey: HDVGQNDLJKJMJF-UHFFFAOYSA-N.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl 5-oxa-2,8-diazaspiro[3.5]nonane-8-carboxylate |
| InChIKey | HDVGQNDLJKJMJF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC2(C1)CNC2 |
Computed by PubChem (NCBI)