cas: 165894-06-4 — see every product listed under this CAS number, including other names
tert-Butyl 6,7-dihydropyrazolo[1,5-a]pyrazine-5(4H)-carboxylate 96% (CAS 165894-06-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A566152-100mg |
| cas | 165894-06-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 492.75 Pln | |
| Ambeed | 250mg | 748.62 Pln | |
| Ambeed | 1g | 1855.56 Pln | |
| Ambeed | 5g | 6950.81 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A566152 |
Tert-butyl 6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate (CAS 165894-06-4) is a chemical compound with the molecular formula C11H17N3O2 and a molecular weight of 223.27 g/mol. IUPAC name: tert-butyl 6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate. InChIKey: DVXJIVBUWXAWHA-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O2 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | tert-butyl 6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate |
| InChIKey | DVXJIVBUWXAWHA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN2C(=CC=N2)C1 |
Computed by PubChem (NCBI)