cas: 890839-29-9 — see every product listed under this CAS number, including other names
tert-Butyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-1-carboxylate 95% (CAS 890839-29-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1145084-100mg |
| cas | 890839-29-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 2089.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1145084 |
Tert-butyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylate (CAS 890839-29-9) is a chemical compound with the molecular formula C18H25BN2O4 and a molecular weight of 344.2 g/mol. IUPAC name: tert-butyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylate. InChIKey: YUDDGOUBTYNGSF-UHFFFAOYSA-N.
| Molecular formula | C18H25BN2O4 |
|---|---|
| Molecular weight | 344.2 g/mol |
| IUPAC name | tert-butyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylate |
| InChIKey | YUDDGOUBTYNGSF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C=NN3C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)