cas: 1147557-97-8 — see every product listed under this CAS number, including other names
tert-Butyl 6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate, 98%, 98% (CAS 1147557-97-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111F71-100mg |
| cas | 1147557-97-8 |
| size | 100mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 170.00 Pln | |
| Chemat | 10g | 266.00 Pln | |
| Chemat | 25g | 534.80 Pln | |
| Chemat | 100g | 1888.40 Pln | |
| Chemat | 50g | 990.80 Pln | |
| Chemat | 500g | 4036.80 Pln | |
| Chemat | 1kg | 7485.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate (CAS 1147557-97-8) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl 6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate. InChIKey: UMXXHZDEAZUQKZ-UHFFFAOYSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl 6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate |
| InChIKey | UMXXHZDEAZUQKZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC(C2)O |
Computed by PubChem (NCBI)