cas: 1147557-97-8 — see every product listed under this CAS number, including other names
tert-butyl 6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate 95% (CAS 1147557-97-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A331968-100mg |
| cas | 1147557-97-8 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 298.06 Pln | |
| Ambeed | 10g | 520.56 Pln | |
| Ambeed | 25g | 1026.75 Pln | |
| Ambeed | 100g | 3841.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A331968 |
Tert-butyl 6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate (CAS 1147557-97-8) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl 6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate. InChIKey: UMXXHZDEAZUQKZ-UHFFFAOYSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl 6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate |
| InChIKey | UMXXHZDEAZUQKZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC(C2)O |
Computed by PubChem (NCBI)