cas: 192869-49-1 — see every product listed under this CAS number, including other names
tert-Butyl 7,8-dihydropyrido[4,3-d]pyrimidine-6(5H)-carboxylate, 97% (CAS 192869-49-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F227845-250MG |
| cas | 192869-49-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 81.24 Pln | |
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 320.74 Pln | |
| Fluorochem | 100g | 5261.71 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate (CAS 192869-49-1) is a chemical compound with the molecular formula C12H17N3O2 and a molecular weight of 235.28 g/mol. IUPAC name: tert-butyl 7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate. InChIKey: CEMDDESVTHLXHH-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O2 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | tert-butyl 7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate |
| InChIKey | CEMDDESVTHLXHH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=NC=NC=C2C1 |
Computed by PubChem (NCBI)