cas: 1147423-01-5 — see every product listed under this CAS number, including other names
tert-Butyl 7-acetyl-2,7-diazaspiro(3.5)nonane-2-carboxylate, 95% (CAS 1147423-01-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A298364-10g |
| cas | 1147423-01-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 8552.53 Pln | |
| AmBeed | 25g | 16996.00 Pln | |
| AmBeed | 5g | 6007.12 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 7-acetyl-2,7-diazaspiro[3.5]nonane-2-carboxylate (CAS 1147423-01-5) is a chemical compound with the molecular formula C14H24N2O3 and a molecular weight of 268.35 g/mol. IUPAC name: tert-butyl 7-acetyl-2,7-diazaspiro[3.5]nonane-2-carboxylate. InChIKey: MVUWNKLIJBZNTD-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O3 |
|---|---|
| Molecular weight | 268.35 g/mol |
| IUPAC name | tert-butyl 7-acetyl-2,7-diazaspiro[3.5]nonane-2-carboxylate |
| InChIKey | MVUWNKLIJBZNTD-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2(CC1)CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)