cas: 1147423-01-5 — see every product listed under this CAS number, including other names
tert-Butyl 7-acetyl-2,7-diazaspiro[3.5]nonane-2-carboxylate, 98% (CAS 1147423-01-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F377791-250MG |
| cas | 1147423-01-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 534.20 Pln | |
| Fluorochem | 1g | 1018.41 Pln | |
| Fluorochem | 5g | 3215.55 Pln | |
| Fluorochem | 10g | 5329.39 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 7-acetyl-2,7-diazaspiro[3.5]nonane-2-carboxylate (CAS 1147423-01-5) is a chemical compound with the molecular formula C14H24N2O3 and a molecular weight of 268.35 g/mol. IUPAC name: tert-butyl 7-acetyl-2,7-diazaspiro[3.5]nonane-2-carboxylate. InChIKey: MVUWNKLIJBZNTD-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O3 |
|---|---|
| Molecular weight | 268.35 g/mol |
| IUPAC name | tert-butyl 7-acetyl-2,7-diazaspiro[3.5]nonane-2-carboxylate |
| InChIKey | MVUWNKLIJBZNTD-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2(CC1)CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)