cas: 1221818-31-0 — see every product listed under this CAS number, including other names
tert-Butyl 7-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate, 97% (CAS 1221818-31-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F614011-100MG |
| cas | 1221818-31-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 601.89 Pln | |
| Fluorochem | 250mg | 924.69 Pln | |
| Fluorochem | 500mg | 1518.23 Pln | |
| Fluorochem | 1g | 2632.42 Pln | |
| Fluorochem | 5g | 8192.97 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 7-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate (CAS 1221818-31-0) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl 7-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate. InChIKey: TZYFUEGUSGTHRA-UHFFFAOYSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl 7-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | TZYFUEGUSGTHRA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CCC1C2O |
Computed by PubChem (NCBI)