cas: 1913261-00-3 — see every product listed under this CAS number, including other names
tert-Butyl 8-bromo-2H-benzo[b][1,4]oxazine-4(3H)-carboxylate 98% (CAS 1913261-00-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A469668-100mg |
| cas | 1913261-00-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 542.81 Pln | |
| Ambeed | 250mg | 798.69 Pln | |
| Ambeed | 1g | 1883.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A469668 |
Tert-butyl 8-bromo-2,3-dihydro-1,4-benzoxazine-4-carboxylate (CAS 1913261-00-3) is a chemical compound with the molecular formula C13H16BrNO3 and a molecular weight of 314.17 g/mol. IUPAC name: tert-butyl 8-bromo-2,3-dihydro-1,4-benzoxazine-4-carboxylate. InChIKey: BVODSCCVOQXLGX-UHFFFAOYSA-N.
| Molecular formula | C13H16BrNO3 |
|---|---|
| Molecular weight | 314.17 g/mol |
| IUPAC name | tert-butyl 8-bromo-2,3-dihydro-1,4-benzoxazine-4-carboxylate |
| InChIKey | BVODSCCVOQXLGX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC2=C1C=CC=C2Br |
Computed by PubChem (NCBI)