cas: 1061731-86-9 — see every product listed under this CAS number, including other names
tert-Butyl 8-oxo-3,9-diazaspiro[5.5]undecane-3-carboxylate, 97%, 97% (CAS 1061731-86-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1107UE-100mg |
| cas | 1061731-86-9 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 770.00 Pln | |
| Chemat | 5g | 2661.20 Pln | |
| Chemat | 10g | 4432.40 Pln | |
| Chemat | 500mg | 482.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 10-oxo-3,9-diazaspiro[5.5]undecane-3-carboxylate (CAS 1061731-86-9) is a chemical compound with the molecular formula C14H24N2O3 and a molecular weight of 268.35 g/mol. IUPAC name: tert-butyl 10-oxo-3,9-diazaspiro[5.5]undecane-3-carboxylate. InChIKey: NICATZPYVMNDQX-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O3 |
|---|---|
| Molecular weight | 268.35 g/mol |
| IUPAC name | tert-butyl 10-oxo-3,9-diazaspiro[5.5]undecane-3-carboxylate |
| InChIKey | NICATZPYVMNDQX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCNC(=O)C2)CC1 |
Computed by PubChem (NCBI)