cas: 1061731-86-9 — see every product listed under this CAS number, including other names
tert-Butyl 8-oxo-3,9-diazaspiro[5.5]undecane-3-carboxylate, 97% (CAS 1061731-86-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F450110-100MG |
| cas | 1061731-86-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 346.77 Pln | |
| Fluorochem | 250mg | 549.82 Pln | |
| Fluorochem | 500mg | 981.96 Pln | |
| Fluorochem | 1g | 1320.39 Pln | |
| Fluorochem | 5g | 3923.64 Pln | |
| Fluorochem | 10g | 6506.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 10-oxo-3,9-diazaspiro[5.5]undecane-3-carboxylate (CAS 1061731-86-9) is a chemical compound with the molecular formula C14H24N2O3 and a molecular weight of 268.35 g/mol. IUPAC name: tert-butyl 10-oxo-3,9-diazaspiro[5.5]undecane-3-carboxylate. InChIKey: NICATZPYVMNDQX-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O3 |
|---|---|
| Molecular weight | 268.35 g/mol |
| IUPAC name | tert-butyl 10-oxo-3,9-diazaspiro[5.5]undecane-3-carboxylate |
| InChIKey | NICATZPYVMNDQX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCNC(=O)C2)CC1 |
Computed by PubChem (NCBI)