cas: 1061731-86-9 — see every product listed under this CAS number, including other names
tert-Butyl 8-oxo-3,9-diazaspiro[5.5]undecane-3-carboxylate, 97% (CAS 1061731-86-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F450110-100MG |
| cas | 1061731-86-9 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 362.39 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 500mg | 888.25 Pln | |
| Fluorochem | 1g | 1185.02 Pln | |
| Fluorochem | 5g | 3507.12 Pln | |
| Fluorochem | 10g | 5834.42 Pln | |
| Ambeed | 250mg | 492.75 Pln | |
| Ambeed | 1g | 1182.50 Pln | |
| Ambeed | 5g | 3457.56 Pln | |
| Ambeed | 10g | 5704.81 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Tert-butyl 10-oxo-3,9-diazaspiro[5.5]undecane-3-carboxylate (CAS 1061731-86-9) is a chemical compound with the molecular formula C14H24N2O3 and a molecular weight of 268.35 g/mol. IUPAC name: tert-butyl 10-oxo-3,9-diazaspiro[5.5]undecane-3-carboxylate. InChIKey: NICATZPYVMNDQX-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O3 |
|---|---|
| Molecular weight | 268.35 g/mol |
| IUPAC name | tert-butyl 10-oxo-3,9-diazaspiro[5.5]undecane-3-carboxylate |
| InChIKey | NICATZPYVMNDQX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCNC(=O)C2)CC1 |
Computed by PubChem (NCBI)