cas: 873924-07-3 — see every product listed under this CAS number, including other names
tert-Butyl 9-oxo-3-azaspiro[5.5]undec-10-ene-3-carboxylate, 95% (CAS 873924-07-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F613682-250MG |
| cas | 873924-07-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 685.19 Pln | |
| Fluorochem | 500mg | 1028.82 Pln | |
| Fluorochem | 1g | 1294.35 Pln | |
| Fluorochem | 5g | 3887.19 Pln | |
| Fluorochem | 10g | 6433.17 Pln | |
| Fluorochem | 25g | 12790.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 9-oxo-3-azaspiro[5.5]undec-10-ene-3-carboxylate (CAS 873924-07-3) is a chemical compound with the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. IUPAC name: tert-butyl 9-oxo-3-azaspiro[5.5]undec-10-ene-3-carboxylate. InChIKey: QAHLORULIOPMFV-UHFFFAOYSA-N.
| Molecular formula | C15H23NO3 |
|---|---|
| Molecular weight | 265.35 g/mol |
| IUPAC name | tert-butyl 9-oxo-3-azaspiro[5.5]undec-10-ene-3-carboxylate |
| InChIKey | QAHLORULIOPMFV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCC(=O)C=C2)CC1 |
Computed by PubChem (NCBI)