cas: 132234-69-6 — see every product listed under this CAS number, including other names
tert-Butyl N-[(3-endo)-8-azabicyclo[3.2.1]octan-3-yl]carbamate, 97%, 97% (CAS 132234-69-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1121EW-5g |
| cas | 132234-69-6 |
| size | 5g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 1715.60 Pln | |
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 10g | 2426.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]carbamate (CAS 132234-69-6) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl N-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]carbamate. InChIKey: UUHPKKKRSZBQIG-ULKQDVFKSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl N-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]carbamate |
| InChIKey | UUHPKKKRSZBQIG-ULKQDVFKSA-N |
| SMILES | CC(C)(C)OC(=O)NC1C[C@H]2CC[C@@H](C1)N2 |
Computed by PubChem (NCBI)