cas: 28387-66-8 — see every product listed under this CAS number, including other names
tert-Butyl N-[(3-hydroxyphenyl)methyl]carbamate, 98% (CAS 28387-66-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F635645-250MG |
| cas | 28387-66-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 810.15 Pln | |
| Fluorochem | 5g | 2481.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[(3-hydroxyphenyl)methyl]carbamate (CAS 28387-66-8) is a chemical compound with the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. IUPAC name: tert-butyl N-[(3-hydroxyphenyl)methyl]carbamate. InChIKey: JEQIMDDMLRIZKL-UHFFFAOYSA-N.
| Molecular formula | C12H17NO3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | tert-butyl N-[(3-hydroxyphenyl)methyl]carbamate |
| InChIKey | JEQIMDDMLRIZKL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC(=CC=C1)O |
Computed by PubChem (NCBI)