cas: 419572-19-3 — see every product listed under this CAS number, including other names
tert-Butyl exo-6-formyl-3-azabicyclo[3.1.0]hexane-3-carboxylate, 98%, 98% (CAS 419572-19-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I96T-100mg |
| cas | 419572-19-3 |
| size | 100mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 323.60 Pln | |
| Chemat | 10g | 501.20 Pln | |
| Chemat | 25g | 947.60 Pln | |
| Chemat | 100g | 2877.20 Pln | |
| Chemat | 250g | 4485.20 Pln | |
| Chemat | 500g | 7507.20 Pln | |
| Chemat | 1kg | 14205.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (1S,5R)-6-formyl-3-azabicyclo[3.1.0]hexane-3-carboxylate (CAS 419572-19-3) is a chemical compound with the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. IUPAC name: tert-butyl (1S,5R)-6-formyl-3-azabicyclo[3.1.0]hexane-3-carboxylate. InChIKey: NZZFUILVSGRYMR-JVHMLUBASA-N.
| Molecular formula | C11H17NO3 |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | tert-butyl (1S,5R)-6-formyl-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| InChIKey | NZZFUILVSGRYMR-JVHMLUBASA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2[C@H](C1)C2C=O |
Computed by PubChem (NCBI)