cas: 351370-99-5 — see every product listed under this CAS number, including other names
tert-Butyl octahydro-5H-pyrrolo[3,4-c]pyridine-5-carboxylate 95% (cis) (CAS 351370-99-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A107952-50mg |
| cas | 351370-99-5 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 670.75 Pln | |
| Ambeed | 100mg | 1093.50 Pln | |
| Ambeed | 250mg | 1610.81 Pln | |
| Ambeed | 1g | 2534.19 Pln | |
| Ambeed | 5g | 8680.75 Pln |
| purity | 95% (cis) |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A107952 |
Tert-butyl 1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridine-5-carboxylate (CAS 351370-99-5) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl 1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridine-5-carboxylate. InChIKey: LRTPRHCNWAEZBN-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl 1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridine-5-carboxylate |
| InChIKey | LRTPRHCNWAEZBN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2CNCC2C1 |
Computed by PubChem (NCBI)