cas: 400898-92-2 — see every product listed under this CAS number, including other names
tert-Butyl trans-4-(N-methoxy-N-methylcarbamoyl)cyclohexylcarbamate, 97% (CAS 400898-92-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F095526-1G |
| cas | 400898-92-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1841.04 Pln | |
| Fluorochem | 5g | 5355.42 Pln | |
| Fluorochem | 500mg | 1247.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[4-[methoxy(methyl)carbamoyl]cyclohexyl]carbamate (CAS 400898-92-2) is a chemical compound with the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. IUPAC name: tert-butyl N-[4-[methoxy(methyl)carbamoyl]cyclohexyl]carbamate. InChIKey: VCYMEIIREZLGFN-UHFFFAOYSA-N.
| Molecular formula | C14H26N2O4 |
|---|---|
| Molecular weight | 286.37 g/mol |
| IUPAC name | tert-butyl N-[4-[methoxy(methyl)carbamoyl]cyclohexyl]carbamate |
| InChIKey | VCYMEIIREZLGFN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CC1)C(=O)N(C)OC |
Computed by PubChem (NCBI)