cas: 181308-57-6 — see every product listed under this CAS number, including other names
tert-Butyl trans-4-formylcyclohexylcarbamate 97% (CAS 181308-57-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A717776-100mg |
| cas | 181308-57-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 236.88 Pln | |
| Ambeed | 5g | 776.44 Pln | |
| Ambeed | 10g | 1221.44 Pln | |
| Ambeed | 25g | 2584.25 Pln | |
| Ambeed | 100g | 8113.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A717776 |
Tert-butyl N-(4-formylcyclohexyl)carbamate (CAS 181308-57-6) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl N-(4-formylcyclohexyl)carbamate. InChIKey: GPDBIGSFXXKWQR-UHFFFAOYSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | tert-butyl N-(4-formylcyclohexyl)carbamate |
| InChIKey | GPDBIGSFXXKWQR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CC1)C=O |
Computed by PubChem (NCBI)