cas: 330793-01-6 — see every product listed under this CAS number, including other names
tert-Butyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-carbamate, 97% (CAS 330793-01-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F010781-1G |
| cas | 330793-01-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 128.10 Pln | |
| Fluorochem | 10g | 164.54 Pln | |
| Fluorochem | 25g | 315.53 Pln | |
| Fluorochem | 100g | 1049.65 Pln | |
| Fluorochem | 500g | 5006.59 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (CAS 330793-01-6) is a chemical compound with the molecular formula C17H26BNO4 and a molecular weight of 319.2 g/mol. IUPAC name: tert-butyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate. InChIKey: HSJNIOYPTSKQBD-UHFFFAOYSA-N.
| Molecular formula | C17H26BNO4 |
|---|---|
| Molecular weight | 319.2 g/mol |
| IUPAC name | tert-butyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| InChIKey | HSJNIOYPTSKQBD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)