cas: 1932398-86-1 — see every product listed under this CAS number, including other names
tert-butyl (1R,4S,6R)-6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate, 97%, 97% (CAS 1932398-86-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JUDX-100mg |
| cas | 1932398-86-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 333.20 Pln | |
| Chemat | 500mg | 510.80 Pln | |
| Chemat | 1g | 736.40 Pln | |
| Chemat | 5g | 2166.80 Pln | |
| Chemat | 10g | 3755.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (1R,4S,6R)-6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate (CAS 1932398-86-1) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl (1R,4S,6R)-6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate. InChIKey: PABFVGKPNHVSCG-DJLDLDEBSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl (1R,4S,6R)-6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | PABFVGKPNHVSCG-DJLDLDEBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@@H]1[C@@H](C2)O |
Computed by PubChem (NCBI)