cas: 340256-13-5 — see every product listed under this CAS number, including other names
tert-butyl 2-[(tert-butyl)oxycarbonyl]perhydropyridazine-1-carboxylate, 95%, 95% (CAS 340256-13-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BYJR-100mg |
| cas | 340256-13-5 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 750.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ditert-butyl diazinane-1,2-dicarboxylate (CAS 340256-13-5) is a chemical compound with the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. IUPAC name: ditert-butyl diazinane-1,2-dicarboxylate. InChIKey: ONTYDPNTAVCVKA-UHFFFAOYSA-N.
| Molecular formula | C14H26N2O4 |
|---|---|
| Molecular weight | 286.37 g/mol |
| IUPAC name | ditert-butyl diazinane-1,2-dicarboxylate |
| InChIKey | ONTYDPNTAVCVKA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCCN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)