cas: 1374651-93-0 — see every product listed under this CAS number, including other names
tert-butyl 2-broMo-5-fluoropyridin-4-ylcarbaMate, 95%, 95% (CAS 1374651-93-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11A175-100mg |
| cas | 1374651-93-0 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 443.60 Pln | |
| Chemat | 250mg | 717.20 Pln | |
| Chemat | 1g | 1835.60 Pln | |
| Chemat | 5g | 5507.60 Pln | |
| Chemat | 10g | 9592.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(2-bromo-5-fluoro-4-pyridinyl)carbamate (CAS 1374651-93-0) is a chemical compound with the molecular formula C10H12BrFN2O2 and a molecular weight of 291.12 g/mol. IUPAC name: tert-butyl N-(2-bromo-5-fluoro-4-pyridinyl)carbamate. InChIKey: UPAOPDGTOQVOEK-UHFFFAOYSA-N.
| Molecular formula | C10H12BrFN2O2 |
|---|---|
| Molecular weight | 291.12 g/mol |
| IUPAC name | tert-butyl N-(2-bromo-5-fluoro-4-pyridinyl)carbamate |
| InChIKey | UPAOPDGTOQVOEK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=NC=C1F)Br |
Computed by PubChem (NCBI)